C17H7NO14S2-2 — CID 102001708
4,5-dicarboxy-1,8-disulfoacridine-3,6-dicarboxylate (PubChem CID 102001708) has the molecular formula C17H7NO14S2-2 and a molecular weight of 513.37 g/mol. Its IUPAC name is 4,5-dicarboxy-1,8-disulfoacridine-3,6-dicarboxylate.
| Compound Name | 4,5-dicarboxy-1,8-disulfoacridine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 102001708 |
| Molecular Formula | C17H7NO14S2-2 |
| Molecular Weight | 513.37 g/mol |
| Exact Mass | 512.93 |
| IUPAC Name | 4,5-dicarboxy-1,8-disulfoacridine-3,6-dicarboxylate |
| SMILES | O=C([O-])c1cc(S(=O)(=O)O)c2cc3c(S(=O)(=O)O)cc(C(=O)[O-])c(C(=O)O)c3nc2c1C(=O)O |
| InChI | InChI=1S/C17H9NO14S2/c19-14(20)6-2-8(33(27,28)29)4-1-5-9(34(30,31)32)3-7(15(21)22)11(17(25)26)13(5)18-12(4)10(6)16(23)24/h1-3H,(H,19,20)(H,21,22)(H,23,24)(H,25,26)(H,27,28,29)(H,30,31,32)/p-2 |
| InChIKey | JIEHIMJYXIWELP-UHFFFAOYSA-L |
| XLogP | -2.00 |
| TPSA | 276.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.37 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|