C17H32N2 — CID 143415698
N-(cyclohexa-1,3-dien-1-ylmethyl)-N',N'-dipropylbutane-1,4-diamine (PubChem CID 143415698) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is N-(cyclohexa-1,3-dien-1-ylmethyl)-N',N'-dipropylbutane-1,4-diamine.
| Compound Name | N-(cyclohexa-1,3-dien-1-ylmethyl)-N',N'-dipropylbutane-1,4-diamine |
|---|---|
| PubChem CID | 143415698 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | N-(cyclohexa-1,3-dien-1-ylmethyl)-N',N'-dipropylbutane-1,4-diamine |
| SMILES | CCCN(CCC)CCCCNCC1=CC=CCC1 |
| InChI | InChI=1S/C17H32N2/c1-3-13-19(14-4-2)15-9-8-12-18-16-17-10-6-5-7-11-17/h5-6,10,18H,3-4,7-9,11-16H2,1-2H3 |
| InChIKey | YNSOEHXLXJMONG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|