C12H14N2O2 — CID 143416927
5-[(3Z,5Z)-4-methylhepta-1,3,5-trien-2-yl]oxy-1H-pyrimidin-2-one (PubChem CID 143416927) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 5-[(3Z,5Z)-4-methylhepta-1,3,5-trien-2-yl]oxy-1H-pyrimidin-2-one.
| Compound Name | 5-[(3Z,5Z)-4-methylhepta-1,3,5-trien-2-yl]oxy-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 143416927 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 5-[(3Z,5Z)-4-methylhepta-1,3,5-trien-2-yl]oxy-1H-pyrimidin-2-one |
| SMILES | C=C(/C=C(C)\C=C/C)Oc1cnc(=O)[nH]c1 |
| InChI | InChI=1S/C12H14N2O2/c1-4-5-9(2)6-10(3)16-11-7-13-12(15)14-8-11/h4-8H,3H2,1-2H3,(H,13,14,15)/b5-4-,9-6- |
| InChIKey | GSFVJZJBUGHRHW-WXOLFVLTSA-N |
| XLogP | 2.18 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|