C14H21N3O3 — CID 143418970
pyridin-4-ylmethyl N-[1-[formyl(methyl)amino]-2,2-dimethylpropyl]carbamate (PubChem CID 143418970) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is pyridin-4-ylmethyl N-[1-[formyl(methyl)amino]-2,2-dimethylpropyl]carbamate.
| Compound Name | pyridin-4-ylmethyl N-[1-[formyl(methyl)amino]-2,2-dimethylpropyl]carbamate |
|---|---|
| PubChem CID | 143418970 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | pyridin-4-ylmethyl N-[1-[formyl(methyl)amino]-2,2-dimethylpropyl]carbamate |
| SMILES | CN(C=O)C(NC(=O)OCc1ccncc1)C(C)(C)C |
| InChI | InChI=1S/C14H21N3O3/c1-14(2,3)12(17(4)10-18)16-13(19)20-9-11-5-7-15-8-6-11/h5-8,10,12H,9H2,1-4H3,(H,16,19) |
| InChIKey | IETNXOGDOLZIHR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|