C14H16N+ — CID 143419731
4-[(E)-2-cyclohexa-1,3-dien-1-ylethenyl]-1-methylpyridin-1-ium (PubChem CID 143419731) has the molecular formula C14H16N+ and a molecular weight of 198.29 g/mol. Its IUPAC name is 4-[(E)-2-cyclohexa-1,3-dien-1-ylethenyl]-1-methylpyridin-1-ium.
| Compound Name | 4-[(E)-2-cyclohexa-1,3-dien-1-ylethenyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 143419731 |
| Molecular Formula | C14H16N+ |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 4-[(E)-2-cyclohexa-1,3-dien-1-ylethenyl]-1-methylpyridin-1-ium |
| SMILES | C[n+]1ccc(/C=C/C2=CC=CCC2)cc1 |
| InChI | InChI=1S/C14H16N/c1-15-11-9-14(10-12-15)8-7-13-5-3-2-4-6-13/h2-3,5,7-12H,4,6H2,1H3/q+1/b8-7+ |
| InChIKey | IZULQJDVPSNFCW-BQYQJAHWSA-N |
| XLogP | 2.80 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|