C24H25NO — CID 143420394
2-(3-butylphenyl)-2,2-diphenylacetamide (PubChem CID 143420394) has the molecular formula C24H25NO and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-(3-butylphenyl)-2,2-diphenylacetamide.
| Compound Name | 2-(3-butylphenyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 143420394 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-(3-butylphenyl)-2,2-diphenylacetamide |
| SMILES | CCCCc1cccc(C(C(N)=O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H25NO/c1-2-3-11-19-12-10-17-22(18-19)24(23(25)26,20-13-6-4-7-14-20)21-15-8-5-9-16-21/h4-10,12-18H,2-3,11H2,1H3,(H2,25,26) |
| InChIKey | CYFHNEOOWKPRDR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|