C30H36 — CID 143420401
2-[(2Z,4E,7E,8Z)-5-ethyl-6-methyl-11-phenyl-7-prop-2-enylideneundeca-2,4,8-trien-6-yl]cyclohepta-1,3,5-triene (PubChem CID 143420401) has the molecular formula C30H36 and a molecular weight of 396.62 g/mol. Its IUPAC name is 2-[(2Z,4E,7E,8Z)-5-ethyl-6-methyl-11-phenyl-7-prop-2-enylideneundeca-2,4,8-trien-6-yl]cyclohepta-1,3,5-triene.
| Compound Name | 2-[(2Z,4E,7E,8Z)-5-ethyl-6-methyl-11-phenyl-7-prop-2-enylideneundeca-2,4,8-trien-6-yl]cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 143420401 |
| Molecular Formula | C30H36 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 2-[(2Z,4E,7E,8Z)-5-ethyl-6-methyl-11-phenyl-7-prop-2-enylideneundeca-2,4,8-trien-6-yl]cyclohepta-1,3,5-triene |
| SMILES | C=C/C=C(\C=C/CCc1ccccc1)C(C)(C1=CCC=CC=C1)/C(=C/C=C\C)CC |
| InChI | InChI=1S/C30H36/c1-5-8-22-27(7-3)30(4,29-23-14-9-10-15-24-29)28(18-6-2)25-17-16-21-26-19-12-11-13-20-26/h5-6,8-14,17-20,22-25H,2,7,15-16,21H2,1,3-4H3/b8-5-,25-17-,27-22+,28-18+ |
| InChIKey | JZXIVOMDDDEJAZ-ZYMZATEGSA-N |
| XLogP | 8.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|