C30H38O3 — CID 88892883
(4E)-3-[(1S)-4-[(3E,5Z)-hepta-3,5-dien-3-yl]oxycyclohexa-2,4-dien-1-yl]-2-methyl-4-[(Z)-3-phenoxyprop-1-enyl]hepta-4,6-dien-3-ol (PubChem CID 88892883) has the molecular formula C30H38O3 and a molecular weight of 446.63 g/mol. Its IUPAC name is (4E)-3-[(1S)-4-[(3E,5Z)-hepta-3,5-dien-3-yl]oxycyclohexa-2,4-dien-1-yl]-2-methyl-4-[(Z)-3-phenoxyprop-1-enyl]hepta-4,6-dien-3-ol.
| Compound Name | (4E)-3-[(1S)-4-[(3E,5Z)-hepta-3,5-dien-3-yl]oxycyclohexa-2,4-dien-1-yl]-2-methyl-4-[(Z)-3-phenoxyprop-1-enyl]hepta-4,6-dien-3-ol |
|---|---|
| PubChem CID | 88892883 |
| Molecular Formula | C30H38O3 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | (4E)-3-[(1S)-4-[(3E,5Z)-hepta-3,5-dien-3-yl]oxycyclohexa-2,4-dien-1-yl]-2-methyl-4-[(Z)-3-phenoxyprop-1-enyl]hepta-4,6-dien-3-ol |
| SMILES | C=C/C=C(\C=C/COc1ccccc1)C(O)(C(C)C)[C@@H]1C=CC(O/C(=C/C=C\C)CC)=CC1 |
| InChI | InChI=1S/C30H38O3/c1-6-9-16-27(8-3)33-29-21-19-26(20-22-29)30(31,24(4)5)25(14-7-2)15-13-23-32-28-17-11-10-12-18-28/h6-7,9-19,21-22,24,26,31H,2,8,20,23H2,1,3-5H3/b9-6-,15-13-,25-14+,27-16+/t26-,30?/m1/s1 |
| InChIKey | KTFQRVZBFBNJGY-PYRMXAJDSA-N |
| XLogP | 7.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|