C14H16IO- — CID 156796467
[(2Z,4Z)-2-ethenyliodanuidylhexa-2,4-dienoxy]benzene (PubChem CID 156796467) has the molecular formula C14H16IO- and a molecular weight of 327.19 g/mol. Its IUPAC name is [(2Z,4Z)-2-ethenyliodanuidylhexa-2,4-dienoxy]benzene.
| Compound Name | [(2Z,4Z)-2-ethenyliodanuidylhexa-2,4-dienoxy]benzene |
|---|---|
| PubChem CID | 156796467 |
| Molecular Formula | C14H16IO- |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | [(2Z,4Z)-2-ethenyliodanuidylhexa-2,4-dienoxy]benzene |
| SMILES | C=C[I-]/C(=C\C=C/C)COc1ccccc1 |
| InChI | InChI=1S/C14H16IO/c1-3-5-9-13(15-4-2)12-16-14-10-7-6-8-11-14/h3-11H,2,12H2,1H3/q-1/b5-3-,13-9- |
| InChIKey | XKOLEYQCRWZMTF-KSVDDNJFSA-N |
| XLogP | 0.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|