C18H24O — CID 54130728
2-but-2-enylocta-2,7-dienoxybenzene (PubChem CID 54130728) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-but-2-enylocta-2,7-dienoxybenzene.
| Compound Name | 2-but-2-enylocta-2,7-dienoxybenzene |
|---|---|
| PubChem CID | 54130728 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 2-but-2-enylocta-2,7-dienoxybenzene |
| SMILES | C=CCCCC=C(CC=CC)COc1ccccc1 |
| InChI | InChI=1S/C18H24O/c1-3-5-7-9-13-17(12-6-4-2)16-19-18-14-10-8-11-15-18/h3-4,6,8,10-11,13-15H,1,5,7,9,12,16H2,2H3 |
| InChIKey | NUEDAOBENCIHOW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|