C10H13NO — CID 143420889
1,2,3,4,6,7-hexahydro-1-benzazepin-5-one (PubChem CID 143420889) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 1,2,3,4,6,7-hexahydro-1-benzazepin-5-one.
| Compound Name | 1,2,3,4,6,7-hexahydro-1-benzazepin-5-one |
|---|---|
| PubChem CID | 143420889 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1,2,3,4,6,7-hexahydro-1-benzazepin-5-one |
| SMILES | O=C1CCCNC2=C1CCC=C2 |
| InChI | InChI=1S/C10H13NO/c12-10-6-3-7-11-9-5-2-1-4-8(9)10/h2,5,11H,1,3-4,6-7H2 |
| InChIKey | WGFOKTIBIROGDI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |