C12H19N — CID 145121568
ethane;2,3,4,7-tetrahydro-1H-cyclohepta[b]pyridine (PubChem CID 145121568) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is ethane;2,3,4,7-tetrahydro-1H-cyclohepta[b]pyridine.
| Compound Name | ethane;2,3,4,7-tetrahydro-1H-cyclohepta[b]pyridine |
|---|---|
| PubChem CID | 145121568 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | ethane;2,3,4,7-tetrahydro-1H-cyclohepta[b]pyridine |
| SMILES | C1=CC2=C(C=CC1)NCCC2.CC |
| InChI | InChI=1S/C10H13N.C2H6/c1-2-5-9-6-4-8-11-10(9)7-3-1;1-2/h2-3,5,7,11H,1,4,6,8H2;1-2H3 |
| InChIKey | GRXZBJSTKNZZOX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |