C9H11Cl2N — CID 155677435
6,6-dichloro-2,3,4,5-tetrahydro-1H-quinoline (PubChem CID 155677435) has the molecular formula C9H11Cl2N and a molecular weight of 204.10 g/mol. Its IUPAC name is 6,6-dichloro-2,3,4,5-tetrahydro-1H-quinoline.
| Compound Name | 6,6-dichloro-2,3,4,5-tetrahydro-1H-quinoline |
|---|---|
| PubChem CID | 155677435 |
| Molecular Formula | C9H11Cl2N |
| Molecular Weight | 204.10 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 6,6-dichloro-2,3,4,5-tetrahydro-1H-quinoline |
| SMILES | ClC1(Cl)C=CC2=C(CCCN2)C1 |
| InChI | InChI=1S/C9H11Cl2N/c10-9(11)4-3-8-7(6-9)2-1-5-12-8/h3-4,12H,1-2,5-6H2 |
| InChIKey | ZFXXFOOCFPRGAM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.10 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|