C9H12BrN — CID 177010542
7-bromo-1,2,3,4,5,6-hexahydroquinoline (PubChem CID 177010542) has the molecular formula C9H12BrN and a molecular weight of 214.11 g/mol. Its IUPAC name is 7-bromo-1,2,3,4,5,6-hexahydroquinoline.
| Compound Name | 7-bromo-1,2,3,4,5,6-hexahydroquinoline |
|---|---|
| PubChem CID | 177010542 |
| Molecular Formula | C9H12BrN |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 7-bromo-1,2,3,4,5,6-hexahydroquinoline |
| SMILES | BrC1=CC2=C(CCCN2)CC1 |
| InChI | InChI=1S/C9H12BrN/c10-8-4-3-7-2-1-5-11-9(7)6-8/h6,11H,1-5H2 |
| InChIKey | YZHLDIWYVPQETO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |