C9H12N2 — CID 143106785
2-methyl-1,2,3,6-tetrahydrocyclohepta[d]imidazole (PubChem CID 143106785) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 2-methyl-1,2,3,6-tetrahydrocyclohepta[d]imidazole.
| Compound Name | 2-methyl-1,2,3,6-tetrahydrocyclohepta[d]imidazole |
|---|---|
| PubChem CID | 143106785 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2-methyl-1,2,3,6-tetrahydrocyclohepta[d]imidazole |
| SMILES | CC1NC2=C(C=CCC=C2)N1 |
| InChI | InChI=1S/C9H12N2/c1-7-10-8-5-3-2-4-6-9(8)11-7/h3-7,10-11H,2H2,1H3 |
| InChIKey | GROIJKKSUZUFCV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |