C24H31N3O6 — CID 143421275
3-(2,4-dimethoxyanilino)-2-formyl-N-methyl-N-(6-methyl-3-oxooxazinan-6-yl)benzamide;ethane (PubChem CID 143421275) has the molecular formula C24H31N3O6 and a molecular weight of 457.53 g/mol. Its IUPAC name is 3-(2,4-dimethoxyanilino)-2-formyl-N-methyl-N-(6-methyl-3-oxooxazinan-6-yl)benzamide;ethane.
| Compound Name | 3-(2,4-dimethoxyanilino)-2-formyl-N-methyl-N-(6-methyl-3-oxooxazinan-6-yl)benzamide;ethane |
|---|---|
| PubChem CID | 143421275 |
| Molecular Formula | C24H31N3O6 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 3-(2,4-dimethoxyanilino)-2-formyl-N-methyl-N-(6-methyl-3-oxooxazinan-6-yl)benzamide;ethane |
| SMILES | CC.COc1ccc(Nc2cccc(C(=O)N(C)C3(C)CCC(=O)NO3)c2C=O)c(OC)c1 |
| InChI | InChI=1S/C22H25N3O6.C2H6/c1-22(11-10-20(27)24-31-22)25(2)21(28)15-6-5-7-17(16(15)13-26)23-18-9-8-14(29-3)12-19(18)30-4;1-2/h5-9,12-13,23H,10-11H2,1-4H3,(H,24,27);1-2H3 |
| InChIKey | VYNWFCHAMLNYFY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|