C18H25NOS — CID 143422638
3,3-dimethylbutanal;[4-(5-methylthiophen-2-yl)phenyl]methanamine (PubChem CID 143422638) has the molecular formula C18H25NOS and a molecular weight of 303.47 g/mol. Its IUPAC name is 3,3-dimethylbutanal;[4-(5-methylthiophen-2-yl)phenyl]methanamine.
| Compound Name | 3,3-dimethylbutanal;[4-(5-methylthiophen-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 143422638 |
| Molecular Formula | C18H25NOS |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 3,3-dimethylbutanal;[4-(5-methylthiophen-2-yl)phenyl]methanamine |
| SMILES | CC(C)(C)CC=O.Cc1ccc(-c2ccc(CN)cc2)s1 |
| InChI | InChI=1S/C12H13NS.C6H12O/c1-9-2-7-12(14-9)11-5-3-10(8-13)4-6-11;1-6(2,3)4-5-7/h2-7H,8,13H2,1H3;5H,4H2,1-3H3 |
| InChIKey | WXBOFYDZHFSKJX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|