C17H21N3O3S2 — CID 143423474
[3-(3,4-dimethoxyphenyl)-3-oxopropyl] N-amino-N-(thiophen-2-ylmethyl)carbamimidothioate (PubChem CID 143423474) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-3-oxopropyl] N-amino-N-(thiophen-2-ylmethyl)carbamimidothioate.
| Compound Name | [3-(3,4-dimethoxyphenyl)-3-oxopropyl] N-amino-N-(thiophen-2-ylmethyl)carbamimidothioate |
|---|---|
| PubChem CID | 143423474 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-3-oxopropyl] N-amino-N-(thiophen-2-ylmethyl)carbamimidothioate |
| SMILES | [H]/N=C(/SCCC(=O)c1ccc(OC)c(OC)c1)N(N)Cc1cccs1 |
| InChI | InChI=1S/C17H21N3O3S2/c1-22-15-6-5-12(10-16(15)23-2)14(21)7-9-25-17(18)20(19)11-13-4-3-8-24-13/h3-6,8,10,18H,7,9,11,19H2,1-2H3/b18-17+ |
| InChIKey | BVYKAWQOYIEDJQ-ISLYRVAYSA-N |
| XLogP | 3.38 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|