C19H22ClNO6S — CID 143426299
ethyl 8-(4-chloro-2-methoxycarbonylanilino)sulfanyl-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate (PubChem CID 143426299) has the molecular formula C19H22ClNO6S and a molecular weight of 427.91 g/mol. Its IUPAC name is ethyl 8-(4-chloro-2-methoxycarbonylanilino)sulfanyl-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate.
| Compound Name | ethyl 8-(4-chloro-2-methoxycarbonylanilino)sulfanyl-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
|---|---|
| PubChem CID | 143426299 |
| Molecular Formula | C19H22ClNO6S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | ethyl 8-(4-chloro-2-methoxycarbonylanilino)sulfanyl-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
| SMILES | CCOC(=O)C1=CC2(CCC1SNc1ccc(Cl)cc1C(=O)OC)OCCO2 |
| InChI | InChI=1S/C19H22ClNO6S/c1-3-25-18(23)14-11-19(26-8-9-27-19)7-6-16(14)28-21-15-5-4-12(20)10-13(15)17(22)24-2/h4-5,10-11,16,21H,3,6-9H2,1-2H3 |
| InChIKey | CEEIWHLDIPJDDO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|