C17H19Cl2NO4S — CID 143426348
ethyl 8-(2,4-dichloroanilino)sulfanyl-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate (PubChem CID 143426348) has the molecular formula C17H19Cl2NO4S and a molecular weight of 404.32 g/mol. Its IUPAC name is ethyl 8-(2,4-dichloroanilino)sulfanyl-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate.
| Compound Name | ethyl 8-(2,4-dichloroanilino)sulfanyl-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
|---|---|
| PubChem CID | 143426348 |
| Molecular Formula | C17H19Cl2NO4S |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | ethyl 8-(2,4-dichloroanilino)sulfanyl-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
| SMILES | CCOC(=O)C1=CC2(CCC1SNc1ccc(Cl)cc1Cl)OCCO2 |
| InChI | InChI=1S/C17H19Cl2NO4S/c1-2-22-16(21)12-10-17(23-7-8-24-17)6-5-15(12)25-20-14-4-3-11(18)9-13(14)19/h3-4,9-10,15,20H,2,5-8H2,1H3 |
| InChIKey | NUEGAFJFXIRTRB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|