C20H35Cl — CID 143426425
3-chloro-2-methylbut-1-ene;2-methylbuta-1,3-diene;1,5,5,6-tetramethylcyclohexene (PubChem CID 143426425) has the molecular formula C20H35Cl and a molecular weight of 310.95 g/mol. Its IUPAC name is 3-chloro-2-methylbut-1-ene;2-methylbuta-1,3-diene;1,5,5,6-tetramethylcyclohexene.
| Compound Name | 3-chloro-2-methylbut-1-ene;2-methylbuta-1,3-diene;1,5,5,6-tetramethylcyclohexene |
|---|---|
| PubChem CID | 143426425 |
| Molecular Formula | C20H35Cl |
| Molecular Weight | 310.95 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 3-chloro-2-methylbut-1-ene;2-methylbuta-1,3-diene;1,5,5,6-tetramethylcyclohexene |
| SMILES | C=C(C)C(C)Cl.C=CC(=C)C.CC1=CCCC(C)(C)C1C |
| InChI | InChI=1S/C10H18.C5H9Cl.C5H8/c1-8-6-5-7-10(3,4)9(8)2;1-4(2)5(3)6;1-4-5(2)3/h6,9H,5,7H2,1-4H3;5H,1H2,2-3H3;4H,1-2H2,3H3 |
| InChIKey | AHLCQNGBVWUVCV-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.95 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|