C18H29ClN6O4 — CID 143428506
methyl 2-[2-[[[6-amino-2-butoxy-5-(methylideneamino)pyrimidin-4-yl]-(chloromethyl)amino]methyl]morpholin-4-yl]acetate (PubChem CID 143428506) has the molecular formula C18H29ClN6O4 and a molecular weight of 428.92 g/mol. Its IUPAC name is methyl 2-[2-[[[6-amino-2-butoxy-5-(methylideneamino)pyrimidin-4-yl]-(chloromethyl)amino]methyl]morpholin-4-yl]acetate.
| Compound Name | methyl 2-[2-[[[6-amino-2-butoxy-5-(methylideneamino)pyrimidin-4-yl]-(chloromethyl)amino]methyl]morpholin-4-yl]acetate |
|---|---|
| PubChem CID | 143428506 |
| Molecular Formula | C18H29ClN6O4 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | methyl 2-[2-[[[6-amino-2-butoxy-5-(methylideneamino)pyrimidin-4-yl]-(chloromethyl)amino]methyl]morpholin-4-yl]acetate |
| SMILES | C=Nc1c(N)nc(OCCCC)nc1N(CCl)CC1CN(CC(=O)OC)CCO1 |
| InChI | InChI=1S/C18H29ClN6O4/c1-4-5-7-29-18-22-16(20)15(21-2)17(23-18)25(12-19)10-13-9-24(6-8-28-13)11-14(26)27-3/h13H,2,4-12H2,1,3H3,(H2,20,22,23) |
| InChIKey | KVZRUVQSAZSODB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|