C17H16N2O2 — CID 143438205
5-[(3E)-hexa-1,3,5-trien-3-yl]-2-(4-methylphenyl)-1,3-oxazole-4-carboxamide (PubChem CID 143438205) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 5-[(3E)-hexa-1,3,5-trien-3-yl]-2-(4-methylphenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 5-[(3E)-hexa-1,3,5-trien-3-yl]-2-(4-methylphenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 143438205 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 5-[(3E)-hexa-1,3,5-trien-3-yl]-2-(4-methylphenyl)-1,3-oxazole-4-carboxamide |
| SMILES | C=C/C=C(\C=C)c1oc(-c2ccc(C)cc2)nc1C(N)=O |
| InChI | InChI=1S/C17H16N2O2/c1-4-6-12(5-2)15-14(16(18)20)19-17(21-15)13-9-7-11(3)8-10-13/h4-10H,1-2H2,3H3,(H2,18,20)/b12-6+ |
| InChIKey | IYAAUJGQJLVLFR-WUXMJOGZSA-N |
| XLogP | 3.50 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|