C16H15NO — CID 143438249
2-[(3E)-hexa-1,3,5-trien-3-yl]-4-(4-methylphenyl)-1,3-oxazole (PubChem CID 143438249) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]-4-(4-methylphenyl)-1,3-oxazole.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-4-(4-methylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 143438249 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-4-(4-methylphenyl)-1,3-oxazole |
| SMILES | C=C/C=C(\C=C)c1nc(-c2ccc(C)cc2)co1 |
| InChI | InChI=1S/C16H15NO/c1-4-6-13(5-2)16-17-15(11-18-16)14-9-7-12(3)8-10-14/h4-11H,1-2H2,3H3/b13-6+ |
| InChIKey | MCYRVAOUTHEWFM-AWNIVKPZSA-N |
| XLogP | 4.41 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|