C14H14N2O — CID 145026026
(2E)-N-methyl-2-(5-methyl-1,3-benzoxazol-2-yl)penta-2,4-dien-1-imine (PubChem CID 145026026) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is (2E)-N-methyl-2-(5-methyl-1,3-benzoxazol-2-yl)penta-2,4-dien-1-imine.
| Compound Name | (2E)-N-methyl-2-(5-methyl-1,3-benzoxazol-2-yl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 145026026 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | (2E)-N-methyl-2-(5-methyl-1,3-benzoxazol-2-yl)penta-2,4-dien-1-imine |
| SMILES | C=C/C=C(\C=N\C)c1nc2cc(C)ccc2o1 |
| InChI | InChI=1S/C14H14N2O/c1-4-5-11(9-15-3)14-16-12-8-10(2)6-7-13(12)17-14/h4-9H,1H2,2-3H3/b11-5+,15-9+ |
| InChIKey | DHLLGPQAMAYFFK-UHHZJSQJSA-N |
| XLogP | 3.41 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|