C11H12N2OS — CID 162183308
methyl N-(5-methyl-1,3-benzoxazol-2-yl)ethanimidothioate (PubChem CID 162183308) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is methyl N-(5-methyl-1,3-benzoxazol-2-yl)ethanimidothioate.
| Compound Name | methyl N-(5-methyl-1,3-benzoxazol-2-yl)ethanimidothioate |
|---|---|
| PubChem CID | 162183308 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | methyl N-(5-methyl-1,3-benzoxazol-2-yl)ethanimidothioate |
| SMILES | CSC(C)=Nc1nc2cc(C)ccc2o1 |
| InChI | InChI=1S/C11H12N2OS/c1-7-4-5-10-9(6-7)13-11(14-10)12-8(2)15-3/h4-6H,1-3H3 |
| InChIKey | ZPIDZPVCTXUSAH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|