C18H21F6NO — CID 143439119
(7aS)-5-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole (PubChem CID 143439119) has the molecular formula C18H21F6NO and a molecular weight of 381.36 g/mol. Its IUPAC name is (7aS)-5-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole.
| Compound Name | (7aS)-5-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole |
|---|---|
| PubChem CID | 143439119 |
| Molecular Formula | C18H21F6NO |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (7aS)-5-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole |
| SMILES | CC(OC1CC[C@@H]2CNCC2C1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H21F6NO/c1-10(26-16-3-2-11-8-25-9-13(11)6-16)12-4-14(17(19,20)21)7-15(5-12)18(22,23)24/h4-5,7,10-11,13,16,25H,2-3,6,8-9H2,1H3/t10?,11-,13?,16?/m1/s1 |
| InChIKey | SBTQBXSJZJQWLH-CXGICLJISA-N |
| XLogP | 5.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |