C22H18F7NO4 — CID 87651757
(4S)-4-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-2-oxopiperidin-1-ium-1-carboxylate (PubChem CID 87651757) has the molecular formula C22H18F7NO4 and a molecular weight of 493.38 g/mol. Its IUPAC name is (4S)-4-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-2-oxopiperidin-1-ium-1-carboxylate.
| Compound Name | (4S)-4-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-2-oxopiperidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 87651757 |
| Molecular Formula | C22H18F7NO4 |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | (4S)-4-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-2-oxopiperidin-1-ium-1-carboxylate |
| SMILES | C[C@@H](O[C@H]1CC[N+](C(=O)[O-])(c2ccc(F)cc2)C(=O)C1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H18F7NO4/c1-12(13-8-14(21(24,25)26)10-15(9-13)22(27,28)29)34-18-6-7-30(20(32)33,19(31)11-18)17-4-2-16(23)3-5-17/h2-5,8-10,12,18H,6-7,11H2,1H3/t12-,18+,30?/m1/s1 |
| InChIKey | VPVNJQVWJKCVRO-JJWXWLETSA-N |
| XLogP | 4.98 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|