C28H29F7O5 — CID 87532969
(1S,2S,3R,4S)-4-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1,2-diethyl-3-(4-fluorophenyl)cyclohexane-1,2-dicarboxylic acid (PubChem CID 87532969) has the molecular formula C28H29F7O5 and a molecular weight of 578.52 g/mol. Its IUPAC name is (1S,2S,3R,4S)-4-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1,2-diethyl-3-(4-fluorophenyl)cyclohexane-1,2-dicarboxylic acid.
| Compound Name | (1S,2S,3R,4S)-4-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1,2-diethyl-3-(4-fluorophenyl)cyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 87532969 |
| Molecular Formula | C28H29F7O5 |
| Molecular Weight | 578.52 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | (1S,2S,3R,4S)-4-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1,2-diethyl-3-(4-fluorophenyl)cyclohexane-1,2-dicarboxylic acid |
| SMILES | CC[C@]1(C(=O)O)CC[C@H](O[C@H](C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@H](c2ccc(F)cc2)[C@]1(CC)C(=O)O |
| InChI | InChI=1S/C28H29F7O5/c1-4-25(23(36)37)11-10-21(22(26(25,5-2)24(38)39)16-6-8-20(29)9-7-16)40-15(3)17-12-18(27(30,31)32)14-19(13-17)28(33,34)35/h6-9,12-15,21-22H,4-5,10-11H2,1-3H3,(H,36,37)(H,38,39)/t15-,21+,22+,25-,26-/m1/s1 |
| InChIKey | QYMYBSNCAPRJSF-FBTWIZLCSA-N |
| XLogP | 7.85 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.52 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |