C16H16F6O — CID 89294870
1-[1-[(1S)-3-methylcyclopent-2-en-1-yl]oxyethyl]-3,5-bis(trifluoromethyl)benzene (PubChem CID 89294870) has the molecular formula C16H16F6O and a molecular weight of 338.29 g/mol. Its IUPAC name is 1-[1-[(1S)-3-methylcyclopent-2-en-1-yl]oxyethyl]-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-[1-[(1S)-3-methylcyclopent-2-en-1-yl]oxyethyl]-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 89294870 |
| Molecular Formula | C16H16F6O |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 1-[1-[(1S)-3-methylcyclopent-2-en-1-yl]oxyethyl]-3,5-bis(trifluoromethyl)benzene |
| SMILES | CC1=C[C@@H](OC(C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H16F6O/c1-9-3-4-14(5-9)23-10(2)11-6-12(15(17,18)19)8-13(7-11)16(20,21)22/h5-8,10,14H,3-4H2,1-2H3/t10?,14-/m0/s1 |
| InChIKey | WLQYRZOKGBCRIC-SBNLOKMTSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|