C18H19F6NO3 — CID 89340849
(6R,8R)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-hydroxy-2-methyl-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 89340849) has the molecular formula C18H19F6NO3 and a molecular weight of 411.34 g/mol. Its IUPAC name is (6R,8R)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-hydroxy-2-methyl-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (6R,8R)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-hydroxy-2-methyl-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 89340849 |
| Molecular Formula | C18H19F6NO3 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (6R,8R)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-hydroxy-2-methyl-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | C[C@@H](O[C@@H]1C[C@@H]2CC(C)(O)C(=O)N2C1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H19F6NO3/c1-9(28-14-6-13-7-16(2,27)15(26)25(13)8-14)10-3-11(17(19,20)21)5-12(4-10)18(22,23)24/h3-5,9,13-14,27H,6-8H2,1-2H3/t9-,13-,14-,16?/m1/s1 |
| InChIKey | VUVHUBUMGXSMAW-GMCHMATOSA-N |
| XLogP | 3.93 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |