C22H26ClN3OS — CID 143446580
N-ethyl-2-[(E)-prop-1-enyl]sulfanylbenzenecarboximidoyl chloride;N-(pyridin-3-ylmethyl)but-3-enamide (PubChem CID 143446580) has the molecular formula C22H26ClN3OS and a molecular weight of 415.99 g/mol. Its IUPAC name is N-ethyl-2-[(E)-prop-1-enyl]sulfanylbenzenecarboximidoyl chloride;N-(pyridin-3-ylmethyl)but-3-enamide.
| Compound Name | N-ethyl-2-[(E)-prop-1-enyl]sulfanylbenzenecarboximidoyl chloride;N-(pyridin-3-ylmethyl)but-3-enamide |
|---|---|
| PubChem CID | 143446580 |
| Molecular Formula | C22H26ClN3OS |
| Molecular Weight | 415.99 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-ethyl-2-[(E)-prop-1-enyl]sulfanylbenzenecarboximidoyl chloride;N-(pyridin-3-ylmethyl)but-3-enamide |
| SMILES | C/C=C/Sc1ccccc1/C(Cl)=N/CC.C=CCC(=O)NCc1cccnc1 |
| InChI | InChI=1S/C12H14ClNS.C10H12N2O/c1-3-9-15-11-8-6-5-7-10(11)12(13)14-4-2;1-2-4-10(13)12-8-9-5-3-6-11-7-9/h3,5-9H,4H2,1-2H3;2-3,5-7H,1,4,8H2,(H,12,13)/b9-3+,14-12-; |
| InChIKey | GSTAQKCOTMGXMP-DWIGKVFJSA-N |
| XLogP | 5.59 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.99 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|