C11H18O2 — CID 143447891
ethane;6-methyl-2,3,7,8-tetrahydro-1,4-benzodioxine (PubChem CID 143447891) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is ethane;6-methyl-2,3,7,8-tetrahydro-1,4-benzodioxine.
| Compound Name | ethane;6-methyl-2,3,7,8-tetrahydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 143447891 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | ethane;6-methyl-2,3,7,8-tetrahydro-1,4-benzodioxine |
| SMILES | CC.CC1=CC2=C(CC1)OCCO2 |
| InChI | InChI=1S/C9H12O2.C2H6/c1-7-2-3-8-9(6-7)11-5-4-10-8;1-2/h6H,2-5H2,1H3;1-2H3 |
| InChIKey | UQTPFTXCBMKKCC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |