C24H31NO4 — CID 143448200
butan-1-ol;(E)-3-(4,5-dimethoxy-2-methylphenyl)-3-(4-methoxyphenyl)-2-methylprop-2-enenitrile (PubChem CID 143448200) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is butan-1-ol;(E)-3-(4,5-dimethoxy-2-methylphenyl)-3-(4-methoxyphenyl)-2-methylprop-2-enenitrile.
| Compound Name | butan-1-ol;(E)-3-(4,5-dimethoxy-2-methylphenyl)-3-(4-methoxyphenyl)-2-methylprop-2-enenitrile |
|---|---|
| PubChem CID | 143448200 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | butan-1-ol;(E)-3-(4,5-dimethoxy-2-methylphenyl)-3-(4-methoxyphenyl)-2-methylprop-2-enenitrile |
| SMILES | CCCCO.COc1ccc(/C(=C(/C)C#N)c2cc(OC)c(OC)cc2C)cc1 |
| InChI | InChI=1S/C20H21NO3.C4H10O/c1-13-10-18(23-4)19(24-5)11-17(13)20(14(2)12-21)15-6-8-16(22-3)9-7-15;1-2-3-4-5/h6-11H,1-5H3;5H,2-4H2,1H3/b20-14+; |
| InChIKey | IWYUWCGADKOYHN-RANVTSCRSA-N |
| XLogP | 5.14 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|