C22H28N2O — CID 143450059
3-[(3R,7R,9aR)-3-benzyl-7-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-8-yl]phenol (PubChem CID 143450059) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 3-[(3R,7R,9aR)-3-benzyl-7-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-8-yl]phenol.
| Compound Name | 3-[(3R,7R,9aR)-3-benzyl-7-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-8-yl]phenol |
|---|---|
| PubChem CID | 143450059 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 3-[(3R,7R,9aR)-3-benzyl-7-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-8-yl]phenol |
| SMILES | C[C@H]1CN2C[C@@H](Cc3ccccc3)NC[C@H]2CC1c1cccc(O)c1 |
| InChI | InChI=1S/C22H28N2O/c1-16-14-24-15-19(10-17-6-3-2-4-7-17)23-13-20(24)12-22(16)18-8-5-9-21(25)11-18/h2-9,11,16,19-20,22-23,25H,10,12-15H2,1H3/t16-,19+,20+,22?/m0/s1 |
| InChIKey | IGBQSXQMKWQBAJ-HYDVDZBRSA-N |
| XLogP | 3.40 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |