C21H26N2O3S — CID 143450001
3-[2-(benzenesulfonyl)-7-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-8-yl]phenol (PubChem CID 143450001) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 3-[2-(benzenesulfonyl)-7-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-8-yl]phenol.
| Compound Name | 3-[2-(benzenesulfonyl)-7-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-8-yl]phenol |
|---|---|
| PubChem CID | 143450001 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 3-[2-(benzenesulfonyl)-7-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-8-yl]phenol |
| SMILES | CC1CN2CCN(S(=O)(=O)c3ccccc3)CC2CC1c1cccc(O)c1 |
| InChI | InChI=1S/C21H26N2O3S/c1-16-14-22-10-11-23(27(25,26)20-8-3-2-4-9-20)15-18(22)13-21(16)17-6-5-7-19(24)12-17/h2-9,12,16,18,21,24H,10-11,13-15H2,1H3 |
| InChIKey | PANAJNQDXCDZNC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |