About 3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole
3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole (PubChem CID 143453304) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole.
Analyze 3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole?
The IUPAC name of 3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole (CID 143453304) is 3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole.
What is the SMILES notation for 3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole?
The canonical SMILES for 3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole is Cn1cnc2c1=CC1CC1C=2.
What is the InChIKey of 3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole?
The InChIKey is RWJNFPVTOUXLEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-11-5-10-8-3-6-2-7(6)4-9(8)11/h3-7H,2H2,1H3.
What are the key properties of 3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole?
3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole has a molecular weight of 146.19 g/mol, XLogP of -0.37, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole is sourced from PubChem (CID 143453304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).