C30H32F3N5O2 — CID 143453379
N-[2-oxo-2-[[1-(1-quinolin-2-ylazepan-4-yl)pyrrolidin-3-yl]methylideneamino]ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 143453379) has the molecular formula C30H32F3N5O2 and a molecular weight of 551.61 g/mol. Its IUPAC name is N-[2-oxo-2-[[1-(1-quinolin-2-ylazepan-4-yl)pyrrolidin-3-yl]methylideneamino]ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-oxo-2-[[1-(1-quinolin-2-ylazepan-4-yl)pyrrolidin-3-yl]methylideneamino]ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 143453379 |
| Molecular Formula | C30H32F3N5O2 |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | N-[2-oxo-2-[[1-(1-quinolin-2-ylazepan-4-yl)pyrrolidin-3-yl]methylideneamino]ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(CNC(=O)c1cccc(C(F)(F)F)c1)/N=C/C1CCN(C2CCCN(c3ccc4ccccc4n3)CC2)C1 |
| InChI | InChI=1S/C30H32F3N5O2/c31-30(32,33)24-7-3-6-23(17-24)29(40)35-19-28(39)34-18-21-12-15-38(20-21)25-8-4-14-37(16-13-25)27-11-10-22-5-1-2-9-26(22)36-27/h1-3,5-7,9-11,17-18,21,25H,4,8,12-16,19-20H2,(H,35,40)/b34-18+ |
| InChIKey | YGNUGXXSNDDPQR-FABQOPTDSA-N |
| XLogP | 4.96 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|