C20H17F6N3O2 — CID 143456387
(5R)-5-(3-methoxy-2-methylphenyl)-1-(2,2,2-trifluoroethanimidoyl)-7-(trifluoromethyl)-5H-4,1-benzoxazepin-2-imine (PubChem CID 143456387) has the molecular formula C20H17F6N3O2 and a molecular weight of 445.36 g/mol. Its IUPAC name is (5R)-5-(3-methoxy-2-methylphenyl)-1-(2,2,2-trifluoroethanimidoyl)-7-(trifluoromethyl)-5H-4,1-benzoxazepin-2-imine.
| Compound Name | (5R)-5-(3-methoxy-2-methylphenyl)-1-(2,2,2-trifluoroethanimidoyl)-7-(trifluoromethyl)-5H-4,1-benzoxazepin-2-imine |
|---|---|
| PubChem CID | 143456387 |
| Molecular Formula | C20H17F6N3O2 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | (5R)-5-(3-methoxy-2-methylphenyl)-1-(2,2,2-trifluoroethanimidoyl)-7-(trifluoromethyl)-5H-4,1-benzoxazepin-2-imine |
| SMILES | [H]/N=C1\CO[C@H](c2cccc(OC)c2C)c2cc(C(F)(F)F)ccc2N1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C20H17F6N3O2/c1-10-12(4-3-5-15(10)30-2)17-13-8-11(19(21,22)23)6-7-14(13)29(16(27)9-31-17)18(28)20(24,25)26/h3-8,17,27-28H,9H2,1-2H3/b27-16+,28-18+/t17-/m1/s1 |
| InChIKey | QBCXASCEVHPYLW-WOEWRWMISA-N |
| XLogP | 5.47 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|