C22H20ClF4N3O3S — CID 143455306
ethyl 2-[(5S)-7-chloro-5-(2-fluoro-3-methoxyphenyl)-2-imino-1-(2,2,2-trifluoroethanimidoyl)-5H-4,1-benzothiazepin-3-yl]acetate (PubChem CID 143455306) has the molecular formula C22H20ClF4N3O3S and a molecular weight of 517.93 g/mol. Its IUPAC name is ethyl 2-[(5S)-7-chloro-5-(2-fluoro-3-methoxyphenyl)-2-imino-1-(2,2,2-trifluoroethanimidoyl)-5H-4,1-benzothiazepin-3-yl]acetate.
| Compound Name | ethyl 2-[(5S)-7-chloro-5-(2-fluoro-3-methoxyphenyl)-2-imino-1-(2,2,2-trifluoroethanimidoyl)-5H-4,1-benzothiazepin-3-yl]acetate |
|---|---|
| PubChem CID | 143455306 |
| Molecular Formula | C22H20ClF4N3O3S |
| Molecular Weight | 517.93 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | ethyl 2-[(5S)-7-chloro-5-(2-fluoro-3-methoxyphenyl)-2-imino-1-(2,2,2-trifluoroethanimidoyl)-5H-4,1-benzothiazepin-3-yl]acetate |
| SMILES | [H]/N=C1\C(CC(=O)OCC)S[C@H](c2cccc(OC)c2F)c2cc(Cl)ccc2N1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C22H20ClF4N3O3S/c1-3-33-17(31)10-16-20(28)30(21(29)22(25,26)27)14-8-7-11(23)9-13(14)19(34-16)12-5-4-6-15(32-2)18(12)24/h4-9,16,19,28-29H,3,10H2,1-2H3/b28-20+,29-21+/t16?,19-/m1/s1 |
| InChIKey | CXXDOURCFAJWEI-AZPUSQMXSA-N |
| XLogP | 5.97 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.93 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|