C25H25NO — CID 143458350
(Z)-1-[4-[N-(2,3-dimethylphenyl)-C-methylcarbonimidoyl]phenyl]-1-phenylprop-1-en-2-ol (PubChem CID 143458350) has the molecular formula C25H25NO and a molecular weight of 355.48 g/mol. Its IUPAC name is (Z)-1-[4-[N-(2,3-dimethylphenyl)-C-methylcarbonimidoyl]phenyl]-1-phenylprop-1-en-2-ol.
| Compound Name | (Z)-1-[4-[N-(2,3-dimethylphenyl)-C-methylcarbonimidoyl]phenyl]-1-phenylprop-1-en-2-ol |
|---|---|
| PubChem CID | 143458350 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (Z)-1-[4-[N-(2,3-dimethylphenyl)-C-methylcarbonimidoyl]phenyl]-1-phenylprop-1-en-2-ol |
| SMILES | C/C(O)=C(\c1ccccc1)c1ccc(/C(C)=N/c2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C25H25NO/c1-17-9-8-12-24(18(17)2)26-19(3)21-13-15-23(16-14-21)25(20(4)27)22-10-6-5-7-11-22/h5-16,27H,1-4H3/b25-20-,26-19+ |
| InChIKey | FAAHOIXTRGMGRG-LLVLDVBMSA-N |
| XLogP | 6.78 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|