C22H28O3 — CID 143461690
3-[1-[(3Z,5E)-5-methoxyhepta-1,3,5-trien-2-yl]cycloheptyl]benzoic acid (PubChem CID 143461690) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 3-[1-[(3Z,5E)-5-methoxyhepta-1,3,5-trien-2-yl]cycloheptyl]benzoic acid.
| Compound Name | 3-[1-[(3Z,5E)-5-methoxyhepta-1,3,5-trien-2-yl]cycloheptyl]benzoic acid |
|---|---|
| PubChem CID | 143461690 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 3-[1-[(3Z,5E)-5-methoxyhepta-1,3,5-trien-2-yl]cycloheptyl]benzoic acid |
| SMILES | C=C(/C=C\C(=C/C)OC)C1(c2cccc(C(=O)O)c2)CCCCCC1 |
| InChI | InChI=1S/C22H28O3/c1-4-20(25-3)13-12-17(2)22(14-7-5-6-8-15-22)19-11-9-10-18(16-19)21(23)24/h4,9-13,16H,2,5-8,14-15H2,1,3H3,(H,23,24)/b13-12-,20-4+ |
| InChIKey | AOINWNRLWAMVFK-YXGSIAPFSA-N |
| XLogP | 5.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|