About 1-[3-[(Z,2E)-2-ethylidenepent-3-enoyl]phenyl]cyclopropane-1-carboxylic acid
1-[3-[(Z,2E)-2-ethylidenepent-3-enoyl]phenyl]cyclopropane-1-carboxylic acid (PubChem CID 72949024) has the molecular formula C17H18O3
and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-[3-[(Z,2E)-2-ethylidenepent-3-enoyl]phenyl]cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[3-[(Z,2E)-2-ethylidenepent-3-enoyl]phenyl]cyclopropane-1-carboxylic acid |
| PubChem CID | 72949024 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-[3-[(Z,2E)-2-ethylidenepent-3-enoyl]phenyl]cyclopropane-1-carboxylic acid |
| SMILES | C/C=C\C(=C/C)C(=O)c1cccc(C2(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C17H18O3/c1-3-6-12(4-2)15(18)13-7-5-8-14(11-13)17(9-10-17)16(19)20/h3-8,11H,9-10H2,1-2H3,(H,19,20)/b6-3-,12-4+ |
| InChIKey | FLOUYTIZKYMDEW-OJCJLYEQSA-N |
| XLogP | 3.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[(Z,2E)-2-ethylidenepent-3-enoyl]phenyl]cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(Z,2E)-2-ethylidenepent-3-enoyl]phenyl]cyclopropane-1-carboxylic acid?
The IUPAC name of 1-[3-[(Z,2E)-2-ethylidenepent-3-enoyl]phenyl]cyclopropane-1-carboxylic acid (CID 72949024) is 1-[3-[(Z,2E)-2-ethylidenepent-3-enoyl]phenyl]cyclopropane-1-carboxylic acid.
What is the SMILES notation for 1-[3-[(Z,2E)-2-ethylidenepent-3-enoyl]phenyl]cyclopropane-1-carboxylic acid?
The canonical SMILES for 1-[3-[(Z,2E)-2-ethylidenepent-3-enoyl]phenyl]cyclopropane-1-carboxylic acid is C/C=C\C(=C/C)C(=O)c1cccc(C2(C(=O)O)CC2)c1.
What is the InChIKey of 1-[3-[(Z,2E)-2-ethylidenepent-3-enoyl]phenyl]cyclopropane-1-carboxylic acid?
The InChIKey is FLOUYTIZKYMDEW-OJCJLYEQSA-N. The full InChI is InChI=1S/C17H18O3/c1-3-6-12(4-2)15(18)13-7-5-8-14(11-13)17(9-10-17)16(19)20/h3-8,11H,9-10H2,1-2H3,(H,19,20)/b6-3-,12-4+.
What are the key properties of 1-[3-[(Z,2E)-2-ethylidenepent-3-enoyl]phenyl]cyclopropane-1-carboxylic acid?
1-[3-[(Z,2E)-2-ethylidenepent-3-enoyl]phenyl]cyclopropane-1-carboxylic acid has a molecular weight of 270.33 g/mol, XLogP of 3.51, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(Z,2E)-2-ethylidenepent-3-enoyl]phenyl]cyclopropane-1-carboxylic acid is sourced from PubChem (CID 72949024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).