C26H42N4O5 — CID 143462621
[(E)-4-[[3-[[(2R,5S)-5-hydroxy-2-tetracyclo[5.2.1.03,8.05,8]decanyl]amino]-2-methanimidoyl-2-methyl-1-(2-methylpropoxy)-3-oxopropyl]amino]-2,2-dimethylbut-3-enyl] carbamate (PubChem CID 143462621) has the molecular formula C26H42N4O5 and a molecular weight of 490.65 g/mol. Its IUPAC name is [(E)-4-[[3-[[(2R,5S)-5-hydroxy-2-tetracyclo[5.2.1.03,8.05,8]decanyl]amino]-2-methanimidoyl-2-methyl-1-(2-methylpropoxy)-3-oxopropyl]amino]-2,2-dimethylbut-3-enyl] carbamate.
| Compound Name | [(E)-4-[[3-[[(2R,5S)-5-hydroxy-2-tetracyclo[5.2.1.03,8.05,8]decanyl]amino]-2-methanimidoyl-2-methyl-1-(2-methylpropoxy)-3-oxopropyl]amino]-2,2-dimethylbut-3-enyl] carbamate |
|---|---|
| PubChem CID | 143462621 |
| Molecular Formula | C26H42N4O5 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | [(E)-4-[[3-[[(2R,5S)-5-hydroxy-2-tetracyclo[5.2.1.03,8.05,8]decanyl]amino]-2-methanimidoyl-2-methyl-1-(2-methylpropoxy)-3-oxopropyl]amino]-2,2-dimethylbut-3-enyl] carbamate |
| SMILES | [H]/N=C/C(C)(C(=O)N[C@@H]1C2CC3C[C@]4(O)CC1C34C2)C(N/C=C/C(C)(C)COC(N)=O)OCC(C)C |
| InChI | InChI=1S/C26H42N4O5/c1-15(2)12-34-21(29-7-6-23(3,4)14-35-22(28)32)24(5,13-27)20(31)30-19-16-8-17-10-25(33)11-18(19)26(17,25)9-16/h6-7,13,15-19,21,27,29,33H,8-12,14H2,1-5H3,(H2,28,32)(H,30,31)/b7-6+,27-13+/t16?,17?,18?,19-,21?,24?,25+,26?/m1/s1 |
| InChIKey | JYOMRWFIXKQFHJ-QKCCHATPSA-N |
| XLogP | 2.53 |
| TPSA | 146.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|