C20H35N3O3 — CID 143664822
(Z)-N-[(2R)-5-hydroxy-3,7-dimethyl-2-bicyclo[3.3.1]nonanyl]-2-methanimidoyl-3-(methylamino)-3-(2-methylpropoxy)prop-2-enamide (PubChem CID 143664822) has the molecular formula C20H35N3O3 and a molecular weight of 365.52 g/mol. Its IUPAC name is (Z)-N-[(2R)-5-hydroxy-3,7-dimethyl-2-bicyclo[3.3.1]nonanyl]-2-methanimidoyl-3-(methylamino)-3-(2-methylpropoxy)prop-2-enamide.
| Compound Name | (Z)-N-[(2R)-5-hydroxy-3,7-dimethyl-2-bicyclo[3.3.1]nonanyl]-2-methanimidoyl-3-(methylamino)-3-(2-methylpropoxy)prop-2-enamide |
|---|---|
| PubChem CID | 143664822 |
| Molecular Formula | C20H35N3O3 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.27 |
| IUPAC Name | (Z)-N-[(2R)-5-hydroxy-3,7-dimethyl-2-bicyclo[3.3.1]nonanyl]-2-methanimidoyl-3-(methylamino)-3-(2-methylpropoxy)prop-2-enamide |
| SMILES | [H]/N=C/C(C(=O)N[C@@H]1C(C)CC2(O)CC(C)CC1C2)=C(\NC)OCC(C)C |
| InChI | InChI=1S/C20H35N3O3/c1-12(2)11-26-19(22-5)16(10-21)18(24)23-17-14(4)8-20(25)7-13(3)6-15(17)9-20/h10,12-15,17,21-22,25H,6-9,11H2,1-5H3,(H,23,24)/b19-16-,21-10+/t13?,14?,15?,17-,20?/m1/s1 |
| InChIKey | RTCDDXKGMLXGSN-IYRZWYGGSA-N |
| XLogP | 2.43 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|