C31H49N5O5 — CID 152961827
[4-[[[(Z)-3-[[(E)-3-(cyclopentanecarbonylamino)-3-methylbut-1-enyl]amino]-2-methanimidoyl-3-(2-methylpropoxy)prop-2-enoyl]amino]methyl]-1-adamantyl] carbamate (PubChem CID 152961827) has the molecular formula C31H49N5O5 and a molecular weight of 571.76 g/mol. Its IUPAC name is [4-[[[(Z)-3-[[(E)-3-(cyclopentanecarbonylamino)-3-methylbut-1-enyl]amino]-2-methanimidoyl-3-(2-methylpropoxy)prop-2-enoyl]amino]methyl]-1-adamantyl] carbamate.
| Compound Name | [4-[[[(Z)-3-[[(E)-3-(cyclopentanecarbonylamino)-3-methylbut-1-enyl]amino]-2-methanimidoyl-3-(2-methylpropoxy)prop-2-enoyl]amino]methyl]-1-adamantyl] carbamate |
|---|---|
| PubChem CID | 152961827 |
| Molecular Formula | C31H49N5O5 |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.37 |
| IUPAC Name | [4-[[[(Z)-3-[[(E)-3-(cyclopentanecarbonylamino)-3-methylbut-1-enyl]amino]-2-methanimidoyl-3-(2-methylpropoxy)prop-2-enoyl]amino]methyl]-1-adamantyl] carbamate |
| SMILES | [H]/N=C/C(C(=O)NCC1C2CC3CC1CC(OC(N)=O)(C3)C2)=C(\N/C=C/C(C)(C)NC(=O)C1CCCC1)OCC(C)C |
| InChI | InChI=1S/C31H49N5O5/c1-19(2)18-40-28(34-10-9-30(3,4)36-26(37)21-7-5-6-8-21)24(16-32)27(38)35-17-25-22-11-20-12-23(25)15-31(13-20,14-22)41-29(33)39/h9-10,16,19-23,25,32,34H,5-8,11-15,17-18H2,1-4H3,(H2,33,39)(H,35,38)(H,36,37)/b10-9+,28-24-,32-16+ |
| InChIKey | OLYKVFIYPJKEHB-HVUJINFFSA-N |
| XLogP | 4.11 |
| TPSA | 155.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|