C30H45N7O2 — CID 143466544
3-(3-carbamimidoylphenyl)-1-(3,3-diphenylpropyl)-1-[2-(2-hydroxyethylamino)ethyl]urea;ethane;methylhydrazine (PubChem CID 143466544) has the molecular formula C30H45N7O2 and a molecular weight of 535.74 g/mol. Its IUPAC name is 3-(3-carbamimidoylphenyl)-1-(3,3-diphenylpropyl)-1-[2-(2-hydroxyethylamino)ethyl]urea;ethane;methylhydrazine.
| Compound Name | 3-(3-carbamimidoylphenyl)-1-(3,3-diphenylpropyl)-1-[2-(2-hydroxyethylamino)ethyl]urea;ethane;methylhydrazine |
|---|---|
| PubChem CID | 143466544 |
| Molecular Formula | C30H45N7O2 |
| Molecular Weight | 535.74 g/mol |
| Exact Mass | 535.36 |
| IUPAC Name | 3-(3-carbamimidoylphenyl)-1-(3,3-diphenylpropyl)-1-[2-(2-hydroxyethylamino)ethyl]urea;ethane;methylhydrazine |
| SMILES | CC.CNN.[H]/N=C(\N)c1cccc(NC(=O)N(CCNCCO)CCC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H33N5O2.C2H6.CH6N2/c28-26(29)23-12-7-13-24(20-23)31-27(34)32(18-15-30-16-19-33)17-14-25(21-8-3-1-4-9-21)22-10-5-2-6-11-22;1-2;1-3-2/h1-13,20,25,30,33H,14-19H2,(H3,28,29)(H,31,34);1-2H3;3H,2H2,1H3 |
| InChIKey | PTZQEFWACKFQAA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 152.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.74 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|