C25H44F3NO2 — CID 143472294
ethane;(2S)-2-[(3-methoxyphenyl)methoxy]-1-methylpyrrolidine;1,1,1-trifluoro-2,3-dimethyloctane (PubChem CID 143472294) has the molecular formula C25H44F3NO2 and a molecular weight of 447.63 g/mol. Its IUPAC name is ethane;(2S)-2-[(3-methoxyphenyl)methoxy]-1-methylpyrrolidine;1,1,1-trifluoro-2,3-dimethyloctane.
| Compound Name | ethane;(2S)-2-[(3-methoxyphenyl)methoxy]-1-methylpyrrolidine;1,1,1-trifluoro-2,3-dimethyloctane |
|---|---|
| PubChem CID | 143472294 |
| Molecular Formula | C25H44F3NO2 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.33 |
| IUPAC Name | ethane;(2S)-2-[(3-methoxyphenyl)methoxy]-1-methylpyrrolidine;1,1,1-trifluoro-2,3-dimethyloctane |
| SMILES | CC.CCCCCC(C)C(C)C(F)(F)F.COc1cccc(CO[C@H]2CCCN2C)c1 |
| InChI | InChI=1S/C13H19NO2.C10H19F3.C2H6/c1-14-8-4-7-13(14)16-10-11-5-3-6-12(9-11)15-2;1-4-5-6-7-8(2)9(3)10(11,12)13;1-2/h3,5-6,9,13H,4,7-8,10H2,1-2H3;8-9H,4-7H2,1-3H3;1-2H3/t13-;;/m0../s1 |
| InChIKey | QVIWPAXBKQXFNS-GXKRWWSZSA-N |
| XLogP | 7.69 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|