C15H25NO2 — CID 143473469
ethane;(2S)-2-[(4-methoxyphenyl)methoxy]-1-methylpyrrolidine (PubChem CID 143473469) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is ethane;(2S)-2-[(4-methoxyphenyl)methoxy]-1-methylpyrrolidine.
| Compound Name | ethane;(2S)-2-[(4-methoxyphenyl)methoxy]-1-methylpyrrolidine |
|---|---|
| PubChem CID | 143473469 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | ethane;(2S)-2-[(4-methoxyphenyl)methoxy]-1-methylpyrrolidine |
| SMILES | CC.COc1ccc(CO[C@H]2CCCN2C)cc1 |
| InChI | InChI=1S/C13H19NO2.C2H6/c1-14-9-3-4-13(14)16-10-11-5-7-12(15-2)8-6-11;1-2/h5-8,13H,3-4,9-10H2,1-2H3;1-2H3/t13-;/m0./s1 |
| InChIKey | ALKJADNICPSRHX-ZOWNYOTGSA-N |
| XLogP | 3.29 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |