C11H12F3NO3 — CID 143478506
2,3-dihydroxy-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 143478506) has the molecular formula C11H12F3NO3 and a molecular weight of 263.21 g/mol. Its IUPAC name is 2,3-dihydroxy-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | 2,3-dihydroxy-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 143478506 |
| Molecular Formula | C11H12F3NO3 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2,3-dihydroxy-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)C(O)CO |
| InChI | InChI=1S/C11H12F3NO3/c12-11(13,14)8-3-1-7(2-4-8)5-15-10(18)9(17)6-16/h1-4,9,16-17H,5-6H2,(H,15,18) |
| InChIKey | YTLRXYCUWLNRBY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |